C25H34FN5S — CID 100789080
1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100789080) has the molecular formula C25H34FN5S and a molecular weight of 455.65 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100789080 |
| Molecular Formula | C25H34FN5S |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclohexyl]methyl]-3-[4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(N2CCC(C)CC2)nc(NC(=S)NCC2(c3ccc(F)cc3)CCCCC2)n1 |
| InChI | InChI=1S/C25H34FN5S/c1-18-10-14-31(15-11-18)22-16-19(2)28-23(29-22)30-24(32)27-17-25(12-4-3-5-13-25)20-6-8-21(26)9-7-20/h6-9,16,18H,3-5,10-15,17H2,1-2H3,(H2,27,28,29,30,32) |
| InChIKey | HSLVGNOHKVWTOI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|