C18H18N6S2 — CID 100783074
1-[(4-methylphenyl)methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea (PubChem CID 100783074) has the molecular formula C18H18N6S2 and a molecular weight of 382.52 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[(4-methylphenyl)methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100783074 |
| Molecular Formula | C18H18N6S2 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2nc(C)cc(Sc3ncccn3)n2)cc1 |
| InChI | InChI=1S/C18H18N6S2/c1-12-4-6-14(7-5-12)11-21-17(25)24-16-22-13(2)10-15(23-16)26-18-19-8-3-9-20-18/h3-10H,11H2,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | BSPICRYMTKKLGF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|