C16H16N6OS2 — CID 100779219
1-[(5-methylfuran-2-yl)methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea (PubChem CID 100779219) has the molecular formula C16H16N6OS2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 1-[(5-methylfuran-2-yl)methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[(5-methylfuran-2-yl)methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100779219 |
| Molecular Formula | C16H16N6OS2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-[(5-methylfuran-2-yl)methyl]-3-(4-methyl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
| SMILES | Cc1cc(Sc2ncccn2)nc(NC(=S)NCc2ccc(C)o2)n1 |
| InChI | InChI=1S/C16H16N6OS2/c1-10-8-13(25-16-17-6-3-7-18-16)21-14(20-10)22-15(24)19-9-12-5-4-11(2)23-12/h3-8H,9H2,1-2H3,(H2,19,20,21,22,24) |
| InChIKey | JWZBCNKBSRAXDU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|