C20H23N7OS2 — CID 100778690
1-(furan-2-ylmethyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea (PubChem CID 100778690) has the molecular formula C20H23N7OS2 and a molecular weight of 441.59 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100778690 |
| Molecular Formula | C20H23N7OS2 |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1CCCN(c2cc(Sc3ncccn3)nc(NC(=S)NCc3ccco3)n2)C1 |
| InChI | InChI=1S/C20H23N7OS2/c1-14-5-2-9-27(13-14)16-11-17(30-20-21-7-4-8-22-20)25-18(24-16)26-19(29)23-12-15-6-3-10-28-15/h3-4,6-8,10-11,14H,2,5,9,12-13H2,1H3,(H2,23,24,25,26,29)/t14-/m0/s1 |
| InChIKey | CSVUINHZNGFJHL-AWEZNQCLSA-N |
| XLogP | 3.73 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|