C23H27N7S2 — CID 100782777
1-[(4-methylphenyl)methyl]-3-[4-(4-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea (PubChem CID 100782777) has the molecular formula C23H27N7S2 and a molecular weight of 465.65 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-3-[4-(4-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-methylphenyl)methyl]-3-[4-(4-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100782777 |
| Molecular Formula | C23H27N7S2 |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-3-[4-(4-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2nc(Sc3ncccn3)cc(N3CCC(C)CC3)n2)cc1 |
| InChI | InChI=1S/C23H27N7S2/c1-16-4-6-18(7-5-16)15-26-22(31)29-21-27-19(30-12-8-17(2)9-13-30)14-20(28-21)32-23-24-10-3-11-25-23/h3-7,10-11,14,17H,8-9,12-13,15H2,1-2H3,(H2,26,27,28,29,31) |
| InChIKey | NUXWKKZDNMUBEI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|