C21H23N7O2S2 — CID 100781155
1-[(4-methoxyphenyl)methyl]-3-(4-morpholin-4-yl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea (PubChem CID 100781155) has the molecular formula C21H23N7O2S2 and a molecular weight of 469.60 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-(4-morpholin-4-yl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-(4-morpholin-4-yl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100781155 |
| Molecular Formula | C21H23N7O2S2 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-(4-morpholin-4-yl-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
| SMILES | COc1ccc(CNC(=S)Nc2nc(Sc3ncccn3)cc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C21H23N7O2S2/c1-29-16-5-3-15(4-6-16)14-24-20(31)27-19-25-17(28-9-11-30-12-10-28)13-18(26-19)32-21-22-7-2-8-23-21/h2-8,13H,9-12,14H2,1H3,(H2,24,25,26,27,31) |
| InChIKey | WEUAQEYHCLAFMV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|