C23H27N7OS2 — CID 133197117
1-[(4-methoxyphenyl)methyl]-3-[4-(2-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea (PubChem CID 133197117) has the molecular formula C23H27N7OS2 and a molecular weight of 481.65 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[4-(2-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[4-(2-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133197117 |
| Molecular Formula | C23H27N7OS2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[4-(2-methylpiperidin-1-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea |
| SMILES | COc1ccc(CNC(=S)Nc2nc(Sc3ncccn3)cc(N3CCCCC3C)n2)cc1 |
| InChI | InChI=1S/C23H27N7OS2/c1-16-6-3-4-13-30(16)19-14-20(33-23-24-11-5-12-25-23)28-21(27-19)29-22(32)26-15-17-7-9-18(31-2)10-8-17/h5,7-12,14,16H,3-4,6,13,15H2,1-2H3,(H2,26,27,28,29,32) |
| InChIKey | UACAFZAHRTVCBI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|