C25H36N6OS — CID 100781162
1-[(4-methoxyphenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100781162) has the molecular formula C25H36N6OS and a molecular weight of 468.67 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100781162 |
| Molecular Formula | C25H36N6OS |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-(4-methylpiperidin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | COc1ccc(CNC(=S)Nc2nc(N3CCC(C)CC3)cc(N3CCCC[C@@H]3C)n2)cc1 |
| InChI | InChI=1S/C25H36N6OS/c1-18-11-14-30(15-12-18)22-16-23(31-13-5-4-6-19(31)2)28-24(27-22)29-25(33)26-17-20-7-9-21(32-3)10-8-20/h7-10,16,18-19H,4-6,11-15,17H2,1-3H3,(H2,26,27,28,29,33)/t19-/m0/s1 |
| InChIKey | NWGQSJLXDGTLHM-IBGZPJMESA-N |
| XLogP | 4.59 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|