C25H36N6OS — CID 133197099
1-[4-(3,5-dimethylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 133197099) has the molecular formula C25H36N6OS and a molecular weight of 468.67 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 133197099 |
| Molecular Formula | C25H36N6OS |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)Nc2nc(N3CCCCC3)cc(N3CC(C)CC(C)C3)n2)cc1 |
| InChI | InChI=1S/C25H36N6OS/c1-18-13-19(2)17-31(16-18)23-14-22(30-11-5-4-6-12-30)27-24(28-23)29-25(33)26-15-20-7-9-21(32-3)10-8-20/h7-10,14,18-19H,4-6,11-13,15-17H2,1-3H3,(H2,26,27,28,29,33) |
| InChIKey | ZEQDFPUTHOIKBN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|