C28H41N7S — CID 133197317
1-[4-(3,5-dimethylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea (PubChem CID 133197317) has the molecular formula C28H41N7S and a molecular weight of 507.75 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 133197317 |
| Molecular Formula | C28H41N7S |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
| SMILES | CC1CC(C)CN(c2cc(N3CCCCC3)nc(NC(=S)NCc3ccc(N4CCCC4)cc3)n2)C1 |
| InChI | InChI=1S/C28H41N7S/c1-21-16-22(2)20-35(19-21)26-17-25(34-14-4-3-5-15-34)30-27(31-26)32-28(36)29-18-23-8-10-24(11-9-23)33-12-6-7-13-33/h8-11,17,21-22H,3-7,12-16,18-20H2,1-2H3,(H2,29,30,31,32,36) |
| InChIKey | WFRNZCOQKSEKCI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|