C27H39N7S — CID 133197315
1-[4-(3-methylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea (PubChem CID 133197315) has the molecular formula C27H39N7S and a molecular weight of 493.73 g/mol. Its IUPAC name is 1-[4-(3-methylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea.
| Compound Name | 1-[4-(3-methylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 133197315 |
| Molecular Formula | C27H39N7S |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | 1-[4-(3-methylpiperidin-1-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-pyrrolidin-1-ylphenyl)methyl]thiourea |
| SMILES | CC1CCCN(c2cc(N3CCCCC3)nc(NC(=S)NCc3ccc(N4CCCC4)cc3)n2)C1 |
| InChI | InChI=1S/C27H39N7S/c1-21-8-7-17-34(20-21)25-18-24(33-15-3-2-4-16-33)29-26(30-25)31-27(35)28-19-22-9-11-23(12-10-22)32-13-5-6-14-32/h9-12,18,21H,2-8,13-17,19-20H2,1H3,(H2,28,29,30,31,35) |
| InChIKey | TUAINZNIKASPEZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|