C28H34ClN7S — CID 100781575
1-[(4-chlorophenyl)methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 100781575) has the molecular formula C28H34ClN7S and a molecular weight of 536.15 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100781575 |
| Molecular Formula | C28H34ClN7S |
| Molecular Weight | 536.15 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)NCc3ccc(Cl)cc3)n2)C1 |
| InChI | InChI=1S/C28H34ClN7S/c1-21-6-5-13-36(20-21)26-18-25(35-16-14-34(15-17-35)24-7-3-2-4-8-24)31-27(32-26)33-28(37)30-19-22-9-11-23(29)12-10-22/h2-4,7-12,18,21H,5-6,13-17,19-20H2,1H3,(H2,30,31,32,33,37)/t21-/m1/s1 |
| InChIKey | UIVHKPYGRRPXHS-OAQYLSRUSA-N |
| XLogP | 5.18 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.15 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|