C26H33N7OS — CID 133254583
1-(furan-2-ylmethyl)-3-[4-(3-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 133254583) has the molecular formula C26H33N7OS and a molecular weight of 491.67 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[4-(3-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[4-(3-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133254583 |
| Molecular Formula | C26H33N7OS |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[4-(3-methylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CCCN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)NCc3ccco3)n2)C1 |
| InChI | InChI=1S/C26H33N7OS/c1-20-7-5-11-33(19-20)24-17-23(32-14-12-31(13-15-32)21-8-3-2-4-9-21)28-25(29-24)30-26(35)27-18-22-10-6-16-34-22/h2-4,6,8-10,16-17,20H,5,7,11-15,18-19H2,1H3,(H2,27,28,29,30,35) |
| InChIKey | PJELGKABKFAXIB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|