C32H37N7OS — CID 100779520
1-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea (PubChem CID 100779520) has the molecular formula C32H37N7OS and a molecular weight of 567.76 g/mol. Its IUPAC name is 1-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea.
| Compound Name | 1-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100779520 |
| Molecular Formula | C32H37N7OS |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 1-[4-[(3R)-3-methylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)NCc3ccc(-c4ccccc4)o3)n2)C1 |
| InChI | InChI=1S/C32H37N7OS/c1-24-9-8-16-39(23-24)30-21-29(38-19-17-37(18-20-38)26-12-6-3-7-13-26)34-31(35-30)36-32(41)33-22-27-14-15-28(40-27)25-10-4-2-5-11-25/h2-7,10-15,21,24H,8-9,16-20,22-23H2,1H3,(H2,33,34,35,36,41)/t24-/m1/s1 |
| InChIKey | WNFOFNZSAPNUDV-XMMPIXPASA-N |
| XLogP | 5.79 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|