C27H34N6OS — CID 100779383
1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea (PubChem CID 100779383) has the molecular formula C27H34N6OS and a molecular weight of 490.68 g/mol. Its IUPAC name is 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea.
| Compound Name | 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100779383 |
| Molecular Formula | C27H34N6OS |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 1-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
| SMILES | C[C@@H]1C[C@H](C)CN(c2cc(N3CCCC3)nc(NC(=S)NCc3ccc(-c4ccccc4)o3)n2)C1 |
| InChI | InChI=1S/C27H34N6OS/c1-19-14-20(2)18-33(17-19)25-15-24(32-12-6-7-13-32)29-26(30-25)31-27(35)28-16-22-10-11-23(34-22)21-8-4-3-5-9-21/h3-5,8-11,15,19-20H,6-7,12-14,16-18H2,1-2H3,(H2,28,29,30,31,35)/t19-,20+ |
| InChIKey | UGKDVWLMGPQXEQ-BGYRXZFFSA-N |
| XLogP | 5.31 |
| TPSA | 69.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|