C26H32N6O2S — CID 100779455
1-[4-[(3R)-3-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea (PubChem CID 100779455) has the molecular formula C26H32N6O2S and a molecular weight of 492.65 g/mol. Its IUPAC name is 1-[4-[(3R)-3-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea.
| Compound Name | 1-[4-[(3R)-3-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100779455 |
| Molecular Formula | C26H32N6O2S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 1-[4-[(3R)-3-methylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[(5-phenylfuran-2-yl)methyl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCOCC3)nc(NC(=S)NCc3ccc(-c4ccccc4)o3)n2)C1 |
| InChI | InChI=1S/C26H32N6O2S/c1-19-6-5-11-32(18-19)24-16-23(31-12-14-33-15-13-31)28-25(29-24)30-26(35)27-17-21-9-10-22(34-21)20-7-3-2-4-8-20/h2-4,7-10,16,19H,5-6,11-15,17-18H2,1H3,(H2,27,28,29,30,35)/t19-/m1/s1 |
| InChIKey | RIGVWZDCAVNOTI-LJQANCHMSA-N |
| XLogP | 4.30 |
| TPSA | 78.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|