C28H35ClN6OS — CID 133254696
1-[4,6-bis(3-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea (PubChem CID 133254696) has the molecular formula C28H35ClN6OS and a molecular weight of 539.15 g/mol. Its IUPAC name is 1-[4,6-bis(3-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea.
| Compound Name | 1-[4,6-bis(3-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 133254696 |
| Molecular Formula | C28H35ClN6OS |
| Molecular Weight | 539.15 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 1-[4,6-bis(3-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[[5-(4-chlorophenyl)furan-2-yl]methyl]thiourea |
| SMILES | CC1CCCN(c2cc(N3CCCC(C)C3)nc(NC(=S)NCc3ccc(-c4ccc(Cl)cc4)o3)n2)C1 |
| InChI | InChI=1S/C28H35ClN6OS/c1-19-5-3-13-34(17-19)25-15-26(35-14-4-6-20(2)18-35)32-27(31-25)33-28(37)30-16-23-11-12-24(36-23)21-7-9-22(29)10-8-21/h7-12,15,19-20H,3-6,13-14,16-18H2,1-2H3,(H2,30,31,32,33,37) |
| InChIKey | QZVPOEFNMGAAGD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 69.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.15 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|