C24H33ClN6S — CID 100781569
1-[4,6-bis[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-chlorophenyl)methyl]thiourea (PubChem CID 100781569) has the molecular formula C24H33ClN6S and a molecular weight of 473.09 g/mol. Its IUPAC name is 1-[4,6-bis[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-chlorophenyl)methyl]thiourea.
| Compound Name | 1-[4,6-bis[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-chlorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100781569 |
| Molecular Formula | C24H33ClN6S |
| Molecular Weight | 473.09 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 1-[4,6-bis[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-chlorophenyl)methyl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCC[C@@H](C)C3)nc(NC(=S)NCc3ccc(Cl)cc3)n2)C1 |
| InChI | InChI=1S/C24H33ClN6S/c1-17-5-3-11-30(15-17)21-13-22(31-12-4-6-18(2)16-31)28-23(27-21)29-24(32)26-14-19-7-9-20(25)10-8-19/h7-10,13,17-18H,3-6,11-12,14-16H2,1-2H3,(H2,26,27,28,29,32)/t17-,18-/m1/s1 |
| InChIKey | DLZQBADDBBMNJW-QZTJIDSGSA-N |
| XLogP | 5.09 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.09 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|