C19H24ClN5S — CID 125046604
1-[4-chloro-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea (PubChem CID 125046604) has the molecular formula C19H24ClN5S and a molecular weight of 389.96 g/mol. Its IUPAC name is 1-[4-chloro-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea.
| Compound Name | 1-[4-chloro-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 125046604 |
| Molecular Formula | C19H24ClN5S |
| Molecular Weight | 389.96 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-[4-chloro-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-methylphenyl)methyl]thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2nc(Cl)cc(N3CCC[C@H](C)C3)n2)cc1 |
| InChI | InChI=1S/C19H24ClN5S/c1-13-5-7-15(8-6-13)11-21-19(26)24-18-22-16(20)10-17(23-18)25-9-3-4-14(2)12-25/h5-8,10,14H,3-4,9,11-12H2,1-2H3,(H2,21,22,23,24,26)/t14-/m0/s1 |
| InChIKey | QTBUZCFBMYJXAA-AWEZNQCLSA-N |
| XLogP | 4.16 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.96 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|