C16H20ClN5OS — CID 133254604
1-[4-chloro-6-(3-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 133254604) has the molecular formula C16H20ClN5OS and a molecular weight of 365.89 g/mol. Its IUPAC name is 1-[4-chloro-6-(3-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-chloro-6-(3-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 133254604 |
| Molecular Formula | C16H20ClN5OS |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-[4-chloro-6-(3-methylpiperidin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | CC1CCCN(c2cc(Cl)nc(NC(=S)NCc3ccco3)n2)C1 |
| InChI | InChI=1S/C16H20ClN5OS/c1-11-4-2-6-22(10-11)14-8-13(17)19-15(20-14)21-16(24)18-9-12-5-3-7-23-12/h3,5,7-8,11H,2,4,6,9-10H2,1H3,(H2,18,19,20,21,24) |
| InChIKey | IIBDIWCDTSVMAK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|