C18H25N5OS — CID 100779191
1-[(5-methylfuran-2-yl)methyl]-3-[4-methyl-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 100779191) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-[(5-methylfuran-2-yl)methyl]-3-[4-methyl-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(5-methylfuran-2-yl)methyl]-3-[4-methyl-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100779191 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[(5-methylfuran-2-yl)methyl]-3-[4-methyl-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(N2CCC[C@@H](C)C2)nc(NC(=S)NCc2ccc(C)o2)n1 |
| InChI | InChI=1S/C18H25N5OS/c1-12-5-4-8-23(11-12)16-9-13(2)20-17(21-16)22-18(25)19-10-15-7-6-14(3)24-15/h6-7,9,12H,4-5,8,10-11H2,1-3H3,(H2,19,20,21,22,25)/t12-/m1/s1 |
| InChIKey | VUTRTJSBICISLP-GFCCVEGCSA-N |
| XLogP | 3.41 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|