C23H34N6OS — CID 133254630
1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea (PubChem CID 133254630) has the molecular formula C23H34N6OS and a molecular weight of 442.63 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 133254630 |
| Molecular Formula | C23H34N6OS |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(2-methylpiperidin-1-yl)pyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2nc(N3CCCCCC3)cc(N3CCCCC3C)n2)o1 |
| InChI | InChI=1S/C23H34N6OS/c1-17-9-5-8-14-29(17)21-15-20(28-12-6-3-4-7-13-28)25-22(26-21)27-23(31)24-16-19-11-10-18(2)30-19/h10-11,15,17H,3-9,12-14,16H2,1-2H3,(H2,24,25,26,27,31) |
| InChIKey | IPFBYNDXSKHJQB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|