C21H30N6OS — CID 100778992
1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea (PubChem CID 100778992) has the molecular formula C21H30N6OS and a molecular weight of 414.58 g/mol. Its IUPAC name is 1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea.
| Compound Name | 1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100778992 |
| Molecular Formula | C21H30N6OS |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1-[4,6-di(piperidin-1-yl)pyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2nc(N3CCCCC3)cc(N3CCCCC3)n2)o1 |
| InChI | InChI=1S/C21H30N6OS/c1-16-8-9-17(28-16)15-22-21(29)25-20-23-18(26-10-4-2-5-11-26)14-19(24-20)27-12-6-3-7-13-27/h8-9,14H,2-7,10-13,15H2,1H3,(H2,22,23,24,25,29) |
| InChIKey | AWXUCELJDUFWBS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|