C21H23N5OS — CID 100779208
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea (PubChem CID 100779208) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100779208 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-methylpyrimidin-2-yl]-3-[(5-methylfuran-2-yl)methyl]thiourea |
| SMILES | Cc1cc(N2CCc3ccccc3C2)nc(NC(=S)NCc2ccc(C)o2)n1 |
| InChI | InChI=1S/C21H23N5OS/c1-14-11-19(26-10-9-16-5-3-4-6-17(16)13-26)24-20(23-14)25-21(28)22-12-18-8-7-15(2)27-18/h3-8,11H,9-10,12-13H2,1-2H3,(H2,22,23,24,25,28) |
| InChIKey | XRCUMHWBZDMHKQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|