C23H26N6O2S — CID 100778636
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 100778636) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100778636 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | S=C(NCc1ccco1)Nc1nc(N2CCOCC2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C23H26N6O2S/c32-23(24-15-19-6-3-11-31-19)27-22-25-20(28-9-12-30-13-10-28)14-21(26-22)29-8-7-17-4-1-2-5-18(17)16-29/h1-6,11,14H,7-10,12-13,15-16H2,(H2,24,25,26,27,32) |
| InChIKey | JRMNEAOVZYJLNI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|