C26H28N6O3S — CID 100791498
1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 100791498) has the molecular formula C26H28N6O3S and a molecular weight of 504.62 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100791498 |
| Molecular Formula | C26H28N6O3S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | S=C(NCc1ccc2c(c1)OCO2)Nc1nc(N2CCOCC2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C26H28N6O3S/c36-26(27-15-18-5-6-21-22(13-18)35-17-34-21)30-25-28-23(31-9-11-33-12-10-31)14-24(29-25)32-8-7-19-3-1-2-4-20(19)16-32/h1-6,13-14H,7-12,15-17H2,(H2,27,28,29,30,36) |
| InChIKey | UTQOSLQHKKZMTD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|