C26H29FN6S — CID 100783277
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 100783277) has the molecular formula C26H29FN6S and a molecular weight of 476.63 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100783277 |
| Molecular Formula | C26H29FN6S |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | Fc1ccc(CNC(=S)Nc2nc(N3CCCCC3)cc(N3CCc4ccccc4C3)n2)cc1 |
| InChI | InChI=1S/C26H29FN6S/c27-22-10-8-19(9-11-22)17-28-26(34)31-25-29-23(32-13-4-1-5-14-32)16-24(30-25)33-15-12-20-6-2-3-7-21(20)18-33/h2-3,6-11,16H,1,4-5,12-15,17-18H2,(H2,28,29,30,31,34) |
| InChIKey | QZPBMUIVSHGEHA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|