C21H28N6OS — CID 100776767
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-(2-methoxyethyl)thiourea (PubChem CID 100776767) has the molecular formula C21H28N6OS and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 100776767 |
| Molecular Formula | C21H28N6OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrrolidin-1-ylpyrimidin-2-yl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)Nc1nc(N2CCCC2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C21H28N6OS/c1-28-13-9-22-21(29)25-20-23-18(26-10-4-5-11-26)14-19(24-20)27-12-8-16-6-2-3-7-17(16)15-27/h2-3,6-7,14H,4-5,8-13,15H2,1H3,(H2,22,23,24,25,29) |
| InChIKey | MYUHJBWVVLYSRL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|