C25H34N6OS — CID 100778250
1-[4-(azepan-1-yl)-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 100778250) has the molecular formula C25H34N6OS and a molecular weight of 466.66 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100778250 |
| Molecular Formula | C25H34N6OS |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | S=C(NC[C@@H]1CCCO1)Nc1nc(N2CCCCCC2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C25H34N6OS/c33-25(26-17-21-10-7-15-32-21)29-24-27-22(30-12-5-1-2-6-13-30)16-23(28-24)31-14-11-19-8-3-4-9-20(19)18-31/h3-4,8-9,16,21H,1-2,5-7,10-15,17-18H2,(H2,26,27,28,29,33)/t21-/m0/s1 |
| InChIKey | PRCAZHKLFVLJAG-NRFANRHFSA-N |
| XLogP | 3.89 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|