C30H38N8OS — CID 133254511
1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 133254511) has the molecular formula C30H38N8OS and a molecular weight of 558.76 g/mol. Its IUPAC name is 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 133254511 |
| Molecular Formula | C30H38N8OS |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 1-[4,6-bis(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | S=C(NCC1CCCO1)Nc1nc(N2CCN(c3ccccc3)CC2)cc(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C30H38N8OS/c40-30(31-23-26-12-7-21-39-26)34-29-32-27(37-17-13-35(14-18-37)24-8-3-1-4-9-24)22-28(33-29)38-19-15-36(16-20-38)25-10-5-2-6-11-25/h1-6,8-11,22,26H,7,12-21,23H2,(H2,31,32,33,34,40) |
| InChIKey | VKAIZNIRXJADSO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|