C21H34N6O2S — CID 100778104
1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 100778104) has the molecular formula C21H34N6O2S and a molecular weight of 434.61 g/mol. Its IUPAC name is 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 100778104 |
| Molecular Formula | C21H34N6O2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2cc(N3CCOCC3)nc(NC(=S)NC[C@@H]3CCCO3)n2)C1 |
| InChI | InChI=1S/C21H34N6O2S/c1-15-10-16(2)14-27(13-15)19-11-18(26-5-8-28-9-6-26)23-20(24-19)25-21(30)22-12-17-4-3-7-29-17/h11,15-17H,3-10,12-14H2,1-2H3,(H2,22,23,24,25,30)/t15-,16-,17+/m1/s1 |
| InChIKey | BZXSPPXXXLKOLE-ZACQAIPSSA-N |
| XLogP | 2.26 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|