C20H34N6OS — CID 100775794
1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea (PubChem CID 100775794) has the molecular formula C20H34N6OS and a molecular weight of 406.60 g/mol. Its IUPAC name is 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 100775794 |
| Molecular Formula | C20H34N6OS |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)Nc1nc(N2CCOCC2)cc(N2C[C@@H](C)C[C@H](C)C2)n1 |
| InChI | InChI=1S/C20H34N6OS/c1-14(2)11-21-20(28)24-19-22-17(25-5-7-27-8-6-25)10-18(23-19)26-12-15(3)9-16(4)13-26/h10,14-16H,5-9,11-13H2,1-4H3,(H2,21,22,23,24,28)/t15-,16-/m0/s1 |
| InChIKey | LJVMUWYKBCHGBG-HOTGVXAUSA-N |
| XLogP | 2.74 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|