C20H34N6OS — CID 100776350
1-tert-butyl-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 100776350) has the molecular formula C20H34N6OS and a molecular weight of 406.60 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-tert-butyl-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100776350 |
| Molecular Formula | C20H34N6OS |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 1-tert-butyl-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2cc(N3CCOCC3)nc(NC(=S)NC(C)(C)C)n2)C1 |
| InChI | InChI=1S/C20H34N6OS/c1-14-10-15(2)13-26(12-14)17-11-16(25-6-8-27-9-7-25)21-18(22-17)23-19(28)24-20(3,4)5/h11,14-15H,6-10,12-13H2,1-5H3,(H2,21,22,23,24,28)/t14-,15-/m1/s1 |
| InChIKey | DSCATBZQOLBCCR-HUUCEWRRSA-N |
| XLogP | 2.88 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|