C16H26ClN5S — CID 100776678
1-tert-butyl-3-[4-chloro-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 100776678) has the molecular formula C16H26ClN5S and a molecular weight of 355.94 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-chloro-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-tert-butyl-3-[4-chloro-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100776678 |
| Molecular Formula | C16H26ClN5S |
| Molecular Weight | 355.94 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-tert-butyl-3-[4-chloro-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(Cl)nc(NC(=S)NC(C)(C)C)n2)C1 |
| InChI | InChI=1S/C16H26ClN5S/c1-10-6-11(2)9-22(8-10)13-7-12(17)18-14(19-13)20-15(23)21-16(3,4)5/h7,10-11H,6,8-9H2,1-5H3,(H2,18,19,20,21,23)/t10-,11-/m0/s1 |
| InChIKey | AUGZRGOYQREUMK-QWRGUYRKSA-N |
| XLogP | 3.70 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.94 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|