C19H30ClN5S — CID 100791388
1-[4-chloro-6-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-cycloheptylthiourea (PubChem CID 100791388) has the molecular formula C19H30ClN5S and a molecular weight of 396.00 g/mol. Its IUPAC name is 1-[4-chloro-6-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-cycloheptylthiourea.
| Compound Name | 1-[4-chloro-6-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-cycloheptylthiourea |
|---|---|
| PubChem CID | 100791388 |
| Molecular Formula | C19H30ClN5S |
| Molecular Weight | 396.00 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-[4-chloro-6-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-cycloheptylthiourea |
| SMILES | C[C@@H]1C[C@H](C)CN(c2cc(Cl)nc(NC(=S)NC3CCCCCC3)n2)C1 |
| InChI | InChI=1S/C19H30ClN5S/c1-13-9-14(2)12-25(11-13)17-10-16(20)22-18(23-17)24-19(26)21-15-7-5-3-4-6-8-15/h10,13-15H,3-9,11-12H2,1-2H3,(H2,21,22,23,24,26)/t13-,14+ |
| InChIKey | MUNCHQSKYGTEFO-OKILXGFUSA-N |
| XLogP | 4.62 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.00 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|