C18H26F3N5S — CID 100790839
1-cyclopentyl-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100790839) has the molecular formula C18H26F3N5S and a molecular weight of 401.50 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclopentyl-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100790839 |
| Molecular Formula | C18H26F3N5S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-cyclopentyl-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(C(F)(F)F)nc(NC(=S)NC3CCCC3)n2)C1 |
| InChI | InChI=1S/C18H26F3N5S/c1-11-7-12(2)10-26(9-11)15-8-14(18(19,20)21)23-16(24-15)25-17(27)22-13-5-3-4-6-13/h8,11-13H,3-7,9-10H2,1-2H3,(H2,22,23,24,25,27)/t11-,12-/m0/s1 |
| InChIKey | IHJOOOKWCNUTBQ-RYUDHWBXSA-N |
| XLogP | 4.21 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|