C17H24F3N5S — CID 100791103
1-cyclohexyl-3-[4-piperidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100791103) has the molecular formula C17H24F3N5S and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-piperidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclohexyl-3-[4-piperidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100791103 |
| Molecular Formula | C17H24F3N5S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-cyclohexyl-3-[4-piperidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | FC(F)(F)c1cc(N2CCCCC2)nc(NC(=S)NC2CCCCC2)n1 |
| InChI | InChI=1S/C17H24F3N5S/c18-17(19,20)13-11-14(25-9-5-2-6-10-25)23-15(22-13)24-16(26)21-12-7-3-1-4-8-12/h11-12H,1-10H2,(H2,21,22,23,24,26) |
| InChIKey | JHEYZFFTXASHRJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|