C21H24F3N5S — CID 100791120
1-cyclohexyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 100791120) has the molecular formula C21H24F3N5S and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-cyclohexyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100791120 |
| Molecular Formula | C21H24F3N5S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-cyclohexyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | FC(F)(F)c1cc(N2CCc3ccccc3C2)nc(NC(=S)NC2CCCCC2)n1 |
| InChI | InChI=1S/C21H24F3N5S/c22-21(23,24)17-12-18(29-11-10-14-6-4-5-7-15(14)13-29)27-19(26-17)28-20(30)25-16-8-2-1-3-9-16/h4-7,12,16H,1-3,8-11,13H2,(H2,25,26,27,28,30) |
| InChIKey | MHPRMYVISRQBEY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|