C25H29N7S2 — CID 100791306
1-cycloheptyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea (PubChem CID 100791306) has the molecular formula C25H29N7S2 and a molecular weight of 491.69 g/mol. Its IUPAC name is 1-cycloheptyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea.
| Compound Name | 1-cycloheptyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100791306 |
| Molecular Formula | C25H29N7S2 |
| Molecular Weight | 491.69 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 1-cycloheptyl-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]thiourea |
| SMILES | S=C(Nc1nc(Sc2ncccn2)cc(N2CCc3ccccc3C2)n1)NC1CCCCCC1 |
| InChI | InChI=1S/C25H29N7S2/c33-24(28-20-10-3-1-2-4-11-20)31-23-29-21(16-22(30-23)34-25-26-13-7-14-27-25)32-15-12-18-8-5-6-9-19(18)17-32/h5-9,13-14,16,20H,1-4,10-12,15,17H2,(H2,28,29,30,31,33) |
| InChIKey | VPXNYYJAATZXQB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|