C21H21N7S2 — CID 100780477
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-prop-2-enylthiourea (PubChem CID 100780477) has the molecular formula C21H21N7S2 and a molecular weight of 435.58 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 100780477 |
| Molecular Formula | C21H21N7S2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1nc(Sc2ncccn2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C21H21N7S2/c1-2-9-22-20(29)27-19-25-17(13-18(26-19)30-21-23-10-5-11-24-21)28-12-8-15-6-3-4-7-16(15)14-28/h2-7,10-11,13H,1,8-9,12,14H2,(H2,22,25,26,27,29) |
| InChIKey | QQBXARUXUZTEIL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|