C29H29N7OS2 — CID 100789405
1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea (PubChem CID 100789405) has the molecular formula C29H29N7OS2 and a molecular weight of 555.73 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100789405 |
| Molecular Formula | C29H29N7OS2 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
| SMILES | S=C(NCC1(c2ccccc2)CCOCC1)Nc1nc(Sc2ncccn2)cc(N2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C29H29N7OS2/c38-27(32-20-29(11-15-37-16-12-29)23-9-2-1-3-10-23)35-26-33-24(36-18-21-7-4-5-8-22(21)19-36)17-25(34-26)39-28-30-13-6-14-31-28/h1-10,13-14,17H,11-12,15-16,18-20H2,(H2,32,33,34,35,38) |
| InChIKey | BJGHRHQNQMGCMT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|