C30H35ClN6O2S — CID 100789561
1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea (PubChem CID 100789561) has the molecular formula C30H35ClN6O2S and a molecular weight of 579.17 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100789561 |
| Molecular Formula | C30H35ClN6O2S |
| Molecular Weight | 579.17 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]thiourea |
| SMILES | S=C(NCC1(c2ccc(Cl)cc2)CCOCC1)Nc1nc(N2CCOCC2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C30H35ClN6O2S/c31-25-7-5-24(6-8-25)30(10-15-38-16-11-30)21-32-29(40)35-28-33-26(36-13-17-39-18-14-36)19-27(34-28)37-12-9-22-3-1-2-4-23(22)20-37/h1-8,19H,9-18,20-21H2,(H2,32,33,34,35,40) |
| InChIKey | UBFUCYRBEYGKJO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.17 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|