C22H30N6OS — CID 100775802
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea (PubChem CID 100775802) has the molecular formula C22H30N6OS and a molecular weight of 426.59 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 100775802 |
| Molecular Formula | C22H30N6OS |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-morpholin-4-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)Nc1nc(N2CCOCC2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C22H30N6OS/c1-16(2)14-23-22(30)26-21-24-19(27-9-11-29-12-10-27)13-20(25-21)28-8-7-17-5-3-4-6-18(17)15-28/h3-6,13,16H,7-12,14-15H2,1-2H3,(H2,23,24,25,26,30) |
| InChIKey | QTVVBSSWFXSCLT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|