C22H30N6S — CID 100775752
1-[4-(1,3-dihydroisoindol-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea (PubChem CID 100775752) has the molecular formula C22H30N6S and a molecular weight of 410.59 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 100775752 |
| Molecular Formula | C22H30N6S |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)Nc1nc(N2CCCCC2)cc(N2Cc3ccccc3C2)n1 |
| InChI | InChI=1S/C22H30N6S/c1-16(2)13-23-22(29)26-21-24-19(27-10-6-3-7-11-27)12-20(25-21)28-14-17-8-4-5-9-18(17)15-28/h4-5,8-9,12,16H,3,6-7,10-11,13-15H2,1-2H3,(H2,23,24,25,26,29) |
| InChIKey | MXSIKLKMQANVMV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|