C28H34N6S — CID 100785079
1-[4-(azepan-1-yl)-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 100785079) has the molecular formula C28H34N6S and a molecular weight of 486.69 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 100785079 |
| Molecular Formula | C28H34N6S |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | C[C@@H](NC(=S)Nc1nc(N2CCCCCC2)cc(N2CCc3ccccc3C2)n1)c1ccccc1 |
| InChI | InChI=1S/C28H34N6S/c1-21(22-11-5-4-6-12-22)29-28(35)32-27-30-25(33-16-9-2-3-10-17-33)19-26(31-27)34-18-15-23-13-7-8-14-24(23)20-34/h4-8,11-14,19,21H,2-3,9-10,15-18,20H2,1H3,(H2,29,30,31,32,35)/t21-/m1/s1 |
| InChIKey | VMCGEMLIEVSIFS-OAQYLSRUSA-N |
| XLogP | 5.47 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|