C26H38N6S — CID 100785050
1-[4-(azepan-1-yl)-6-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea (PubChem CID 100785050) has the molecular formula C26H38N6S and a molecular weight of 466.70 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 100785050 |
| Molecular Formula | C26H38N6S |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-[(3R,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(1S)-1-phenylethyl]thiourea |
| SMILES | C[C@@H]1C[C@H](C)CN(c2cc(N3CCCCCC3)nc(NC(=S)N[C@@H](C)c3ccccc3)n2)C1 |
| InChI | InChI=1S/C26H38N6S/c1-19-15-20(2)18-32(17-19)24-16-23(31-13-9-4-5-10-14-31)28-25(29-24)30-26(33)27-21(3)22-11-7-6-8-12-22/h6-8,11-12,16,19-21H,4-5,9-10,13-15,17-18H2,1-3H3,(H2,27,28,29,30,33)/t19-,20+,21-/m0/s1 |
| InChIKey | ADIABCCPJYSQQF-HBMCJLEFSA-N |
| XLogP | 5.39 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|