C21H29N5S — CID 133197333
1-[4-(3,5-dimethylpiperidin-1-yl)-6-methylpyrimidin-2-yl]-3-(1-phenylethyl)thiourea (PubChem CID 133197333) has the molecular formula C21H29N5S and a molecular weight of 383.57 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)-6-methylpyrimidin-2-yl]-3-(1-phenylethyl)thiourea.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-methylpyrimidin-2-yl]-3-(1-phenylethyl)thiourea |
|---|---|
| PubChem CID | 133197333 |
| Molecular Formula | C21H29N5S |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)-6-methylpyrimidin-2-yl]-3-(1-phenylethyl)thiourea |
| SMILES | Cc1cc(N2CC(C)CC(C)C2)nc(NC(=S)NC(C)c2ccccc2)n1 |
| InChI | InChI=1S/C21H29N5S/c1-14-10-15(2)13-26(12-14)19-11-16(3)22-20(24-19)25-21(27)23-17(4)18-8-6-5-7-9-18/h5-9,11,14-15,17H,10,12-13H2,1-4H3,(H2,22,23,24,25,27) |
| InChIKey | USXOYNVIGKGECE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|