C20H27N5S — CID 100780937
1-benzyl-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]thiourea (PubChem CID 100780937) has the molecular formula C20H27N5S and a molecular weight of 369.54 g/mol. Its IUPAC name is 1-benzyl-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]thiourea.
| Compound Name | 1-benzyl-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100780937 |
| Molecular Formula | C20H27N5S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-benzyl-3-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-6-methylpyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(N2C[C@H](C)C[C@@H](C)C2)nc(NC(=S)NCc2ccccc2)n1 |
| InChI | InChI=1S/C20H27N5S/c1-14-9-15(2)13-25(12-14)18-10-16(3)22-19(23-18)24-20(26)21-11-17-7-5-4-6-8-17/h4-8,10,14-15H,9,11-13H2,1-3H3,(H2,21,22,23,24,26)/t14-,15-/m1/s1 |
| InChIKey | NCRUCDMUELCVBF-HUUCEWRRSA-N |
| XLogP | 3.75 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|