C29H36ClN7S — CID 133197153
1-[(4-chlorophenyl)methyl]-3-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea (PubChem CID 133197153) has the molecular formula C29H36ClN7S and a molecular weight of 550.18 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133197153 |
| Molecular Formula | C29H36ClN7S |
| Molecular Weight | 550.18 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-(3,5-dimethylpiperidin-1-yl)-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CC(C)CN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)NCc3ccc(Cl)cc3)n2)C1 |
| InChI | InChI=1S/C29H36ClN7S/c1-21-16-22(2)20-37(19-21)27-17-26(36-14-12-35(13-15-36)25-6-4-3-5-7-25)32-28(33-27)34-29(38)31-18-23-8-10-24(30)11-9-23/h3-11,17,21-22H,12-16,18-20H2,1-2H3,(H2,31,32,33,34,38) |
| InChIKey | IKMQKHVQEPWEIX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.18 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|