C27H35N7OS — CID 100778719
1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 100778719) has the molecular formula C27H35N7OS and a molecular weight of 505.69 g/mol. Its IUPAC name is 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100778719 |
| Molecular Formula | C27H35N7OS |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 1-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-6-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(N3CCN(c4ccccc4)CC3)nc(NC(=S)NCc3ccco3)n2)C1 |
| InChI | InChI=1S/C27H35N7OS/c1-20-15-21(2)19-34(18-20)25-16-24(33-12-10-32(11-13-33)22-7-4-3-5-8-22)29-26(30-25)31-27(36)28-17-23-9-6-14-35-23/h3-9,14,16,20-21H,10-13,15,17-19H2,1-2H3,(H2,28,29,30,31,36)/t20-,21-/m0/s1 |
| InChIKey | QCWSXLQFACBVNH-SFTDATJTSA-N |
| XLogP | 4.37 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|